Benzophenone
From Free net encyclopedia
| Benzophenone | |
|---|---|
| Image:Benzophenone.png | |
| General | |
| Systematic name | Benzophenone |
| Other names | diphenylmethanone phenyl ketone diphenyl ketone benzoylbenzene |
| Molecular formula | C13H10O |
| SMILES | O=C(C2=CC=CC=C2)C1=CC=CC=C1 |
| Molar mass | 182.217 g/mol |
| Appearance | white solid |
| CAS number | [119-61-9] |
| Properties | |
| Density and phase | 1.11 g/cm3, solid |
| Solubility in water | insoluble |
| Melting point | 47.9 °C |
| Boiling point | 305.4 °C |
| Acidity (pKa) | ? |
| Dipole moment | |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references | |
Benzophenone, also known as diphenylmethanone, phenyl ketone, diphenyl ketone, or benzoylbenzene. The chemical formula is (C6H5)2CO / Ph2CO. Substituted benzophenones like oxybenzone and dioxybenzone are used in sunscreen. Benzophenone is also used as an indicator for THF stills. The color corresponds qualitatively to the dryness of the still with green and light blue being very wet and dark purple being very dry.
[edit]
External links
[edit]
Reference
- Merck Index, 11th Edition, 1108.