Indapamide
From Free net encyclopedia
|
Image:Indapamide.png | |
| 3-(aminosulfonyl)-4-chloro-N-(2,3-dihydro-2-methyl-1H-indol-l-yl)-benzamide | |
| CAS number 26807-65-8 | ATC code C03BA11 |
| Chemical formula | C16H16ClN3O3S |
| Molecular weight | 365.839 |
| SMILES | NS(=O)(=O)c1cc(ccc1Cl)C(=O)NN2c3ccccc3CC2C |
| Bioavailability | ? |
| Metabolism | ? |
| Elimination half-life | ? |
| Excretion | ? |
| Pregnancy category | ? |
| Legal status | ? |
| Routes of administration | ? |
Indapamide is a thiazide diuretic drug, usually used in the treatment of hypertension.
It is marketed as Bajaten®; Damide®; Fludex®; Indaflex®; Indamol®; Ipamix®; Lozol®; Natrilix®; Noranat®; Tandix®; Veroxil®.Template:Pharma-stub pl:Indapamid